![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Barbara on Treefort.jpg | 2005-03-13 17:03 | 11K | |
| Barbara on Zip Ride.jpg | 2005-03-13 17:03 | 12K | |
| Boys on Swings.jpg | 2005-03-13 17:03 | 10K | |
| Laying out the Structure.jpg | 2005-03-13 17:03 | 9.9K | |
| Playhouse vertical.jpg | 2005-03-13 17:03 | 13K | |
| Sideview.jpg | 2005-03-13 17:03 | 9.5K | |
| Treefort trees before.jpg | 2005-03-13 17:03 | 13K | |
| Treefort with Sean.jpg | 2005-03-13 17:03 | 13K | |
| Treefort with Sean2.jpg | 2005-03-13 17:03 | 12K | |
| Trees before.jpg | 2005-03-13 17:03 | 8.8K | |
| _notes/ | 2014-06-23 20:45 | - | |
| main View Octagon.jpg | 2005-03-13 17:03 | 11K | |
