![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| main View Octagon.jpg | 2005-03-13 17:24 | 85K | |
| _notes/ | 2014-06-23 20:33 | - | |
| Trees before.jpg | 2005-03-13 17:24 | 71K | |
| Treefort with Sean2.jpg | 2005-03-13 17:24 | 45K | |
| Treefort with Sean.jpg | 2005-03-13 17:24 | 49K | |
| Treefort trees before.jpg | 2005-03-13 17:24 | 49K | |
| Sideview.jpg | 2005-03-13 17:24 | 68K | |
| Playhouse vertical.jpg | 2005-03-13 17:24 | 49K | |
| Laying out the Structure.jpg | 2005-03-13 17:24 | 75K | |
| Boys on Swings.jpg | 2005-03-13 17:24 | 67K | |
| Barbara on Zip Ride.jpg | 2005-03-13 17:24 | 80K | |
| Barbara on Treefort.jpg | 2005-03-13 17:24 | 82K | |
