![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Barbara on Treefort.jpg | 2005-03-13 17:28 | 4.8K | |
| Barbara on Zip Ride.jpg | 2005-03-13 17:28 | 5.1K | |
| Boys on Swings.jpg | 2005-03-13 17:28 | 4.7K | |
| Laying out the Structure.jpg | 2005-03-13 17:28 | 4.5K | |
| Playhouse vertical.jpg | 2005-03-13 17:28 | 7.5K | |
| Sideview.jpg | 2005-03-13 17:28 | 4.4K | |
| Treefort trees before.jpg | 2005-03-13 17:28 | 7.4K | |
| Treefort with Sean.jpg | 2005-03-13 17:28 | 7.3K | |
| Treefort with Sean2.jpg | 2005-03-13 17:28 | 7.0K | |
| Trees before.jpg | 2005-03-13 17:28 | 3.9K | |
| _notes/ | 2014-06-23 20:20 | - | |
| main View Octagon.jpg | 2005-03-13 17:28 | 4.9K | |
