![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[IMG]](/icons/image2.gif) | main View Octagon.jpg | 2005-03-13 17:09 | 34K | |
![[DIR]](/icons/folder.gif) | _notes/ | 2014-06-23 20:08 | - | |
| Trees before.jpg | 2005-03-13 17:09 | 28K | |
| Treefort with Sean2.jpg | 2005-03-13 17:09 | 19K | |
| Treefort with Sean.jpg | 2005-03-13 17:09 | 20K | |
| Treefort trees before.jpg | 2005-03-13 17:09 | 20K | |
| Sideview.jpg | 2005-03-13 17:09 | 27K | |
| Playhouse vertical.jpg | 2005-03-13 17:09 | 20K | |
| Laying out the Structure.jpg | 2005-03-13 17:09 | 30K | |
| Boys on Swings.jpg | 2005-03-13 17:09 | 27K | |
| Barbara on Zip Ride.jpg | 2005-03-13 17:09 | 34K | |
| Barbara on Treefort.jpg | 2005-03-13 17:09 | 33K | |
|
|---|
