![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[DIR]](/icons/folder.gif) | Activity Center/ | 2014-06-23 19:56 | - | |
| Activity Center II/ | 2014-06-23 19:56 | - | |
| Adoorable Treehouse/ | 2014-06-23 19:56 | - | |
| Amalgamated HQ/ | 2019-05-11 18:03 | - | |
| Animal Carvings/ | 2014-06-23 19:57 | - | |
| Arched Garden Bridge/ | 2014-06-23 19:57 | - | |
| Atherton3/ | 2014-06-23 19:57 | - | |
| Atherton5/ | 2014-06-23 19:57 | - | |
| Atherton Castle1/ | 2014-06-23 19:57 | - | |
| Atherton Clubhouse/ | 2014-06-23 19:57 | - | |
| Atherton Treehouse/ | 2016-03-03 15:40 | - | |
| Balance Snake Beam/ | 2014-06-23 19:57 | - | |
| Barbaras Garden Playhouse/ | 2014-06-23 19:57 | - | |
| Beds/ | 2014-06-23 19:57 | - | |
| Bel Air Bungalow/ | 2014-06-23 19:57 | - | |
| Belle Bungalow/ | 2014-06-23 19:57 | - | |
| Berkeley Outpost/ | 2014-06-23 19:57 | - | |
| Bike Garage 1/ | 2014-06-23 19:57 | - | |
| Bluebird Treehouse/ | 2014-06-23 19:57 | - | |
| Bowhaus/ | 2014-06-23 19:57 | - | |
| Box Office sign/ | 2014-06-23 19:57 | - | |
| Buckeye Treehouse/ | 2014-06-23 19:57 | - | |
| Built-in Bunk Beds/ | 2014-06-23 19:57 | - | |
| Built-in Cupboard/ | 2014-06-23 19:57 | - | |
| Calico Cottage/ | 2014-06-23 19:57 | - | |
| California Hideout/ | 2014-06-23 19:57 | - | |
| Canyon Perch/ | 2014-06-23 19:58 | - | |
| Cape Codder/ | 2014-06-23 19:58 | - | |
| Cape Codder Deluxe/ | 2014-06-23 19:58 | - | |
| Carolina Castle/ | 2014-06-23 19:58 | - | |
| Carved Climbing Pole/ | 2014-06-23 19:58 | - | |
| Casa de Arbol/ | 2014-06-23 19:58 | - | |
| Castle Colorful/ | 2014-06-23 19:58 | - | |
| Castle Cottage/ | 2014-06-23 19:58 | - | |
| Castle Court/ | 2015-04-30 01:26 | - | |
| Castle Dragon Theater/ | 2014-06-23 19:58 | - | |
| Castle Fantastico/ | 2014-06-23 19:58 | - | |
| Castle Ramparts/ | 2014-06-23 19:58 | - | |
| Castle Starlight/ | 2014-06-23 19:58 | - | |
| Castleland/ | 2014-06-23 19:58 | - | |
| Chair - star/ | 2014-06-23 19:58 | - | |
| Chairs/ | 2014-06-23 19:58 | - | |
| Chalet Playhouse/ | 2014-06-23 19:58 | - | |
| Christys Treefort/ | 2014-06-23 19:58 | - | |
| Classic Picnic Table & Benches/ | 2014-06-23 19:58 | - | |
| Classic Treehouse/ | 2015-03-06 19:42 | - | |
| Cliff Peak Castle/ | 2014-06-23 19:58 | - | |
| Connecticut Castle/ | 2014-06-23 19:59 | - | |
| Contained Play/ | 2014-06-23 19:59 | - | |
| Corner Cupboard/ | 2014-06-23 19:59 | - | |
| Corner Playhouse/ | 2014-06-23 19:59 | - | |
| Count Rococos Castle/ | 2014-06-23 19:59 | - | |
| Country Cottage/ | 2017-06-30 02:32 | - | |
| Country Playhouse/ | 2014-06-23 19:59 | - | |
| Cowabunga/ | 2014-06-23 19:59 | - | |
| Coyote Creek Outpost/ | 2014-06-23 19:59 | - | |
| Coyote Valley Outpost/ | 2014-06-23 19:59 | - | |
| Coyote Valley Treehouse/ | 2014-06-23 19:59 | - | |
| Cozy Cabin/ | 2014-06-23 19:59 | - | |
| Cozy Cabin Plans/ | 2014-06-23 19:59 | - | |
| Crooked Gap Clubhouse/ | 2015-02-28 22:30 | - | |
| Crows Nest/ | 2014-06-23 19:59 | - | |
| Curvy Chalkboard/ | 2014-06-23 19:59 | - | |
| Decision Wheel/ | 2014-06-23 19:59 | - | |
| Designer Playhouse/ | 2014-06-23 19:59 | - | |
| Disney/ | 2014-06-23 19:59 | - | |
| Dreams Happen 2013/ | 2014-06-23 19:59 | - | |
| Dreams Happen 2015/ | 2015-05-11 01:52 | - | |
| Drop Leaf Table & Chairs/ | 2014-06-23 19:59 | - | |
| Drop Leaf Table & Seats/ | 2014-06-23 19:59 | - | |
| Dynamite Treefort/ | 2014-06-23 19:59 | - | |
| East Hampton Treefort/ | 2014-06-23 19:59 | - | |
| Emerald Fortress/ | 2014-06-23 20:00 | - | |
| Escalade Tree Fort/ | 2014-06-23 20:00 | - | |
| Flights of Fancy/ | 2014-06-23 20:00 | - | |
| For Kids Only/ | 2014-06-23 20:00 | - | |
| Forest Hideaway/ | 2014-06-23 20:00 | - | |
| Forest Lookout/ | 2016-04-17 19:07 | - | |
| Forest on First/ | 2014-08-19 22:12 | - | |
| Fort 2s-at-Play/ | 2014-06-23 20:00 | - | |
| Fort Autumn/ | 2014-06-23 20:00 | - | |
| Fort Barbican/ | 2014-06-23 20:00 | - | |
| Fort Barbinga/ | 2014-06-23 20:00 | - | |
| Fort Bethesda/ | 2014-06-23 20:00 | - | |
| Fort Bridget/ | 2014-06-23 20:00 | - | |
| Fort Buckaroo/ | 2017-01-15 02:39 | - | |
| Fort Everything/ | 2014-06-23 20:00 | - | |
| Fort Farwell/ | 2014-06-23 20:00 | - | |
| Fort Fiesta/ | 2014-06-23 20:00 | - | |
| Fort Frontier/ | 2014-06-23 20:00 | - | |
| Fort Funstuff/ | 2014-06-23 20:00 | - | |
| Fort Funtaplay/ | 2014-06-23 20:00 | - | |
| Fort Getaway/ | 2014-06-23 20:00 | - | |
| Fort Harmony/ | 2014-06-23 20:01 | - | |
| Fort Jubilee/ | 2014-06-23 20:01 | - | |
| Fort Kaleidoscope/ | 2014-06-23 20:01 | - | |
| Fort Kinderstube/ | 2014-06-23 20:01 | - | |
| Fort Mediterranean/ | 2014-06-23 20:01 | - | |
| Fort Phoenix/ | 2019-05-12 17:00 | - | |
| Fort Runway/ | 2014-06-23 20:01 | - | |
| Fort Santa Barbara/ | 2014-06-23 20:01 | - | |
| Fort Saratoga/ | 2014-06-23 20:01 | - | |
| Fort Summertime/ | 2014-06-23 20:01 | - | |
| Fort Tuckaway/ | 2014-06-23 20:01 | - | |
| Free-standing 3-Swing Set/ | 2014-06-23 20:01 | - | |
| Freestanding A-Frame Bench Swing/ | 2014-06-23 20:01 | - | |
| Freestanding A-frame Swing Sets/ | 2014-06-23 20:01 | - | |
| Freestanding Buttress Swing Set/ | 2014-06-23 20:01 | - | |
| Gails Tree Fort/ | 2014-06-23 20:01 | - | |
| Garden Playhouse/ | 2018-01-20 02:36 | - | |
| Garden Potpourri/ | 2014-06-23 20:01 | - | |
| Garden Shed/ | 2014-06-23 20:01 | - | |
| Gateway Fortress/ | 2014-06-23 20:01 | - | |
| Giant Rope Swing/ | 2014-06-23 20:01 | - | |
| Gingerbread Playhouse/ | 2014-06-23 20:01 | - | |
| Glendale Gardens/ | 2014-06-23 20:02 | - | |
| Glide away/ | 2014-06-23 20:02 | - | |
| Hand-over-Hand Bars/ | 2014-06-23 20:02 | - | |
| Hidden Treasure/ | 2014-06-23 20:02 | - | |
| Hideaway Fort on Sale/ | 2018-02-02 17:40 | - | |
| Hideaway Forts/ | 2018-07-10 04:10 | - | |
| High Chaparrel/ | 2014-06-23 20:02 | - | |
| Hillbrook Treehouse/ | 2016-07-03 15:49 | - | |
| Hillside Hamlet/ | 2014-06-23 20:02 | - | |
| Hillside Tree Forts/ | 2014-06-23 20:02 | - | |
| Kew Garden Playhouse/ | 2014-07-17 17:41 | - | |
| Kid's Garden Shed/ | 2014-06-23 20:02 | - | |
| Kid's Rule Hutch/ | 2014-06-23 20:02 | - | |
| Kids Barn/ | 2014-06-23 20:02 | - | |
| Kids Rule Table and Chairs/ | 2014-06-23 20:02 | - | |
| Kids Treehouse book/ | 2014-06-23 20:02 | - | |
| King-sized Robin Hood Fort/ | 2014-06-23 20:02 | - | |
| King Size Robin Hood 9/ | 2017-01-17 21:23 | - | |
| King Size Robin Hood 12/ | 2014-06-23 20:02 | - | |
| Kitchen Set/ | 2014-06-23 20:02 | - | |
| Kitty Kat Cottage/ | 2014-06-23 20:03 | - | |
| Korea/ | 2014-06-23 20:03 | - | |
| La Hacienda/ | 2014-06-23 20:03 | - | |
| Ladder-Table/ | 2014-06-23 20:03 | - | |
| Larkspur Castle/ | 2014-06-23 20:03 | - | |
| Le Grand Fort/ | 2014-06-23 20:03 | - | |
| Le Petit Chalet with Swings/ | 2014-06-23 20:03 | - | |
| Lighthouse/ | 2014-06-23 20:03 | - | |
| Long Island Lookout/ | 2014-06-23 20:03 | - | |
| Long Island Treehouse/ | 2014-06-23 20:03 | - | |
| Lookout Tree Fort/ | 2014-06-23 20:03 | - | |
| Los Gatos Treehosue/ | 2014-09-28 01:40 | - | |
| Los Rios Play Structure/ | 2014-06-23 20:03 | - | |
| MAID MARIANS/ | 2014-06-23 20:03 | - | |
| Mad Scientist's Panel/ | 2014-06-23 20:03 | - | |
| Magic Treehouse/ | 2014-06-23 20:03 | - | |
| Magical Bridge / | 2015-04-27 22:49 | - | |
| Magical Bridge Playhouse/ | 2014-06-23 20:03 | - | |
| Majestic Treehouse/ | 2014-06-23 20:03 | - | |
| Malibu Lighthouse/ | 2014-06-30 19:26 | - | |
| Marsh Point Treehouse/ | 2014-07-07 18:30 | - | |
| Mill Valley Victorian/ | 2014-06-23 20:04 | - | |
| Minnesota Treehouse/ | 2014-06-23 20:04 | - | |
| Monkey Bars/ | 2014-06-23 20:04 | - | |
| Napa Valley Chalets/ | 2014-06-23 20:04 | - | |
| Napa Valley Theater/ | 2014-06-23 20:04 | - | |
| No Grown-Ups Allowed/ | 2014-06-23 20:04 | - | |
| Oblique House/ | 2014-06-23 20:04 | - | |
| Outdoor Easel/ | 2014-06-23 20:04 | - | |
| Outdoor Napa Theater/ | 2014-06-23 20:04 | - | |
| Outdoor Theater/ | 2014-06-23 20:04 | - | |
| Painted Bunting/ | 2014-06-23 20:04 | - | |
| Paradise Playhouse/ | 2014-06-23 20:04 | - | |
| Parallel Rings/ | 2014-06-23 20:04 | - | |
| Parker School/ | 2016-12-01 20:34 | - | |
| Pasadena Play Structure/ | 2015-09-21 00:11 | - | |
| Pasadena Playhouse/ | 2015-09-21 17:43 | - | |
| Password Tumbler/ | 2014-06-23 20:04 | - | |
| Perched Playhouse/ | 2014-06-23 20:04 | - | |
| Petit Playhouse/ | 2014-06-23 20:04 | - | |
| Pirate's Haunt/ | 2014-06-23 20:04 | - | |
| Pirates Cupboard/ | 2014-06-23 20:04 | - | |
| Pirates Ship/ | 2014-06-23 20:04 | - | |
| Playhouse in a Tree/ | 2014-06-23 20:04 | - | |
| Pole Perch/ | 2014-06-23 20:05 | - | |
| Portola Valley/ | 2014-06-23 20:05 | - | |
| Pulley Bucket/ | 2014-06-23 20:05 | - | |
| Rapunzel's Retreat/ | 2014-06-23 20:05 | - | |
| Rectangular Cupboard/ | 2014-06-23 20:05 | - | |
| Redwood Treehouse/ | 2014-09-25 23:23 | - | |
| Refurbished Play Structure/ | 2014-06-23 20:05 | - | |
| Robin Hood 9/ | 2017-01-17 21:17 | - | |
| Robin Hood Fort/ | 2017-08-23 14:44 | - | |
| Robin Hood Fort 12/ | 2014-06-23 20:05 | - | |
| Robins Tower/ | 2014-06-23 20:05 | - | |
| Romeo & Juliet's Castle/ | 2014-06-23 20:05 | - | |
| Rosefield Cottage/ | 2014-06-23 20:05 | - | |
| Rough & Tumble Outpost/ | 2014-06-23 20:05 | - | |
| Roughhouse Treehouse/ | 2014-06-23 20:05 | - | |
| Round Picnic Table/ | 2014-06-23 20:05 | - | |
| Rugged Ruckus/ | 2014-06-23 20:05 | - | |
| Rustic Treehouse/ | 2014-06-23 20:05 | - | |
| Rustic playhouses/ | 2014-06-23 20:05 | - | |
| SALE Robin Hood base fort/ | 2014-06-23 20:06 | - | |
| Safe Table/ | 2014-06-23 20:06 | - | |
| Sale Hideaway/ | 2014-06-23 20:06 | - | |
| Seaside Castle/ | 2014-06-23 20:06 | - | |
| Secret Sliding Doors/ | 2014-06-23 20:06 | - | |
| Shelves and Pegs/ | 2014-06-23 20:06 | - | |
| Sheriff's Office/ | 2014-06-23 20:06 | - | |
| Sherriff Office/ | 2014-06-23 20:06 | - | |
| Ship's Ladder/ | 2014-06-23 20:06 | - | |
| Ship's Wheel/ | 2014-06-23 20:06 | - | |
| Ship Ahoy!/ | 2014-06-23 20:06 | - | |
| Ship in a Tree/ | 2014-06-23 20:06 | - | |
| Shipwreck/ | 2014-06-23 20:06 | - | |
![[IMG]](/icons/image2.gif) | Site-Plan.jpg | 2017-08-18 18:44 | 20K | |
| Slide through the Cloud/ | 2014-08-19 18:29 | - | |
| Somerville TSA/ | 2014-08-19 19:06 | - | |
| Southampton Treehouse/ | 2014-06-23 20:06 | - | |
| Speaking Tube/ | 2014-06-23 20:06 | - | |
| Storage/ | 2014-06-23 20:06 | - | |
| Storybook Playhouse/ | 2014-06-23 20:06 | - | |
| Stump House/ | 2014-06-23 20:06 | - | |
| Summerhouse/ | 2014-06-23 20:06 | - | |
| Sunshine Theater/ | 2014-06-23 20:06 | - | |
| Swing Hideaway/ | 2014-06-23 20:06 | - | |
| Swing Sets/ | 2014-07-01 21:51 | - | |
| Swing Turbo Hideaway/ | 2014-06-23 20:06 | - | |
| Swinging Gates/ | 2014-06-23 20:06 | - | |
| Sycamore Treefort/ | 2014-06-23 20:06 | - | |
| TOP SECRET Safe/ | 2014-06-23 20:07 | - | |
| TOPS Treehouse/ | 2015-05-18 18:45 | - | |
| Table and Chairs for Kings and Queens/ | 2014-06-23 20:07 | - | |
| Tables/ | 2014-06-23 20:07 | - | |
| Tables and Chairs/ | 2014-06-23 20:07 | - | |
| Tahoe/ | 2014-06-23 20:07 | - | |
| Tangled Up Treehouse/ | 2014-10-02 00:29 | - | |
| Terra Verde Treehouse/ | 2015-02-16 21:49 | - | |
| Test Product/ | 2014-07-07 18:27 | - | |
| Texas Towers/ | 2014-06-23 20:07 | - | |
| The Clubhouse/ | 2014-06-23 20:07 | - | |
| The Fortress/ | 2014-06-23 20:07 | - | |
| The Holiday Cottage/ | 2014-06-23 20:07 | - | |
| The Inverness Treehouse/ | 2014-10-06 00:50 | - | |
| The Octagon Tower with Roof/ | 2014-06-23 20:07 | - | |
| The Tire Swing/ | 2014-06-23 20:07 | - | |
| The Treehouse/ | 2014-06-23 20:07 | - | |
| Theaters/ | 2014-06-23 20:07 | - | |
| The water cannon/ | 2014-06-23 20:07 | - | |
| Ticket Booth window/ | 2014-06-23 20:07 | - | |
| Timber Terraces/ | 2019-07-23 20:55 | - | |
| Tipee/ | 2014-06-23 20:07 | - | |
| Town Square Theater/ | 2014-06-23 20:07 | - | |
| Toy Box/ | 2014-06-23 20:07 | - | |
| Train Station Office/ | 2014-06-23 20:07 | - | |
| Tree Perches and Zip Lines/ | 2014-06-23 20:07 | - | |
| Tree Side Fort/ | 2014-06-23 20:07 | - | |
| Tree Top Bungalow/ | 2014-06-23 20:07 | - | |
| Tree Top Inn/ | 2014-06-23 20:07 | - | |
| TreeTop Playhouse/ | 2014-06-23 20:07 | - | |
| Treepoline/ | 2016-03-11 17:57 | - | |
| Tropical Treehouse/ | 2014-06-23 20:08 | - | |
| Turbo Hideaway/ | 2018-07-10 04:05 | - | |
| Turnberry Town Square/ | 2014-06-23 20:08 | - | |
| Turnberry Town Square Children's Center: Double Playhouses/ | 2014-06-23 20:08 | - | |
| Tuxedo Castle/ | 2014-06-23 20:08 | - | |
| USED Pasadena Playhouse/ | 2018-10-20 02:37 | - | |
| Used-1.jpg | 2016-05-13 19:02 | 25K | |
| Used-2.jpg | 2016-05-13 19:02 | 16K | |
| Used-3.jpg | 2016-05-13 19:02 | 16K | |
| Used-4.jpg | 2016-05-13 19:02 | 19K | |
| Used Cape Codder/ | 2015-05-21 16:23 | - | |
| Used Castle Ramparts/ | 2016-07-25 01:01 | - | |
| Used Country Playhouse/ | 2014-07-21 14:54 | - | |
| Used Cozy Cabin/ | 2016-07-25 01:27 | - | |
| Used Custom Play Structure/ | 2017-08-23 14:55 | - | |
| Used Fortress with 1 Swing/ | 2014-06-23 20:08 | - | |
| Used Harry Potter Fort/ | 2014-06-23 20:08 | - | |
| Used Hideaway Fort/ | 2018-02-02 18:26 | - | |
| Used Hideaway Fort for sale/ | 2014-06-23 20:08 | - | |
| Used Kew Gardens/ | 2016-10-02 01:35 | - | |
| Used King Fort-2 Swings/ | 2014-10-18 01:40 | - | |
| Used King Fort-9 ft long bridge/ | 2014-06-23 20:08 | - | |
| Used King Fort 2 Swings/ | 2016-05-10 19:00 | - | |
| Used King Fort on Sale/ | 2014-06-23 20:08 | - | |
| Used Redwood Roughhouse/ | 2016-03-24 04:21 | - | |
| Used Robin Hood Fort 1 Swing/ | 2015-04-09 02:34 | - | |
| Used Robin Hood Fort 2 Swings/ | 2015-03-16 18:57 | - | |
| Used Robin Hoods Fort 4ft bridge/ | 2015-06-19 16:53 | - | |
| Used Robins Tower Fort/ | 2017-09-01 22:56 | - | |
| Used Swing Hideaway/ | 2019-09-04 20:39 | - | |
| Used Treetop Bungalow/ | 2021-04-23 00:45 | - | |
| Used Western Fort for Sale/ | 2018-04-24 01:11 | - | |
| Valentines Day/ | 2015-02-14 23:40 | - | |
| Verde Tree Fort/ | 2014-06-23 20:08 | - | |
| Weathered Boards/ | 2014-06-23 20:08 | - | |
| Wendy's House/ | 2014-06-23 20:08 | - | |
| Western Fort/ | 2014-06-23 20:08 | - | |
| Wild Oasis/ | 2014-06-23 20:08 | - | |
| Window Boxes/ | 2014-06-23 20:08 | - | |
| Winter Wonderland/ | 2014-12-07 23:18 | - | |
| Wizards Hideout/ | 2014-06-23 20:08 | - | |
| Woodhaven Castle/ | 2014-06-23 20:09 | - | |
| Woodside Treehouse/ | 2019-04-02 01:56 | - | |
| Zig Zag/ | 2014-06-23 20:09 | - | |
| Zip Line/ | 2015-02-12 23:44 | - | |
| Zip Perch/ | 2016-07-28 03:08 | - | |
| _notes/ | 2014-06-23 20:09 | - | |
| indoors/ | 2014-06-23 20:02 | - | |
| outdoors/ | 2014-06-23 20:04 | - | |
| swings/ | 2014-06-23 20:06 | - | |
|
|---|
